From Wikipedia, the free encyclopedia
Chemical compound
Ansoxetine |
|
ATC code | |
---|
|
6-[3-(dimethylamino)-1-phenylpropoxy]-2-phenyl-4H-chromen-4-one
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
|
Formula | C26H25NO3 |
---|
Molar mass | 399.490 g·mol−1 |
---|
3D model (JSmol) | |
---|
O=C\1c4c(O/C(=C/1)c2ccccc2)ccc(OC(c3ccccc3)CCN(C)C)c4
|
InChI=1S/C26H25NO3/c1-27(2)16-15-24(19-9-5-3-6-10-19)29-21-13-14-25-22(17-21)23(28)18-26(30-25)20-11-7-4-8-12-20/h3-14,17-18,24H,15-16H2,1-2H3 YKey:JDQWJVUVMKPZLU-UHFFFAOYSA-N Y
|
(verify) |
Ansoxetine is the trade name of a type of antidepressant medication. It was never marketed.[1]
References[edit]
|
---|
|
---|
SSRIsTooltip Selective serotonin reuptake inhibitors | |
---|
SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
---|
NRIsTooltip Norepinephrine reuptake inhibitors | |
---|
NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
---|
NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
---|
SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
---|
SMSTooltip Serotonin modulator and stimulators | |
---|
Others | |
---|
|
|
|
---|
TCAsTooltip Tricyclic antidepressants | |
---|
TeCAsTooltip Tetracyclic antidepressants | |
---|
Others | |
---|
|
|
|
---|
Non-selective | |
---|
MAOATooltip Monoamine oxidase A-selective | |
---|
MAOBTooltip Monoamine oxidase B-selective | |
---|
|
|
|
|
|