From Wikipedia, the free encyclopedia
Chemical compound
Renanolone |
|
ATC code | |
---|
|
3α-hydroxy-5β-pregnane-11,20-dione
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
|
Formula | C20H30O4 |
---|
Molar mass | 334.456 g·mol−1 |
---|
3D model (JSmol) | |
---|
CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(O)[C@H]3C(=O)C[C@]12C
|
InChI=1S/C20H30O4/c1-11(21)15-5-6-16-14-4-3-12-9-13(22)7-8-20(12,24)18(14)17(23)10-19(15,16)2/h12-16,18,22,24H,3-10H2,1-2H3/t12-,13-,14+,15-,16+,18-,19-,20-/m1/s1 Key:ICICFVFEPDWWAQ-MNYWXNLXSA-N
|
Renanolone (INN), or 11-ketopregnanolone, also known as 5β-pregnan-3α-ol-11,20-dione, is a synthetic[citation needed] neuroactive steroid which is described as a general anesthetic but was never introduced for clinical use.[1] Its isomers, alfaxolone and alfadolone, are also general anesthetics, and are known to act as positive allosteric modulators of the GABAA receptor, a property which is likely the case for renanolone as well.
Chemistry[edit]
See also[edit]
References[edit]
|
---|
Alcohols | |
---|
Barbiturates | |
---|
Benzodiazepines | |
---|
Carbamates | |
---|
Flavonoids | |
---|
Imidazoles | |
---|
Kava constituents | |
---|
Monoureides | |
---|
Neuroactive steroids | |
---|
Nonbenzodiazepines | |
---|
Phenols | |
---|
Piperidinediones | |
---|
Pyrazolopyridines | |
---|
Quinazolinones | |
---|
Volatiles/gases | |
---|
Others/unsorted |
- 3-Hydroxybutanal
- α-EMTBL
- AA-29504
- Alogabat
- Avermectins (e.g., ivermectin)
- Bromide compounds (e.g., lithium bromide, potassium bromide, sodium bromide)
- Carbamazepine
- Chloralose
- Chlormezanone
- Clomethiazole
- Darigabat
- DEABL
- Deuterated etifoxine
- Dihydroergolines (e.g., dihydroergocryptine, dihydroergosine, dihydroergotamine, ergoloid (dihydroergotoxine))
- DS2
- Efavirenz
- Etazepine
- Etifoxine
- Fenamates (e.g., flufenamic acid, mefenamic acid, niflumic acid, tolfenamic acid)
- Fluoxetine
- Flupirtine
- Hopantenic acid
- KRM-II-81
- Lanthanum
- Lavender oil
- Lignans (e.g., 4-O-methylhonokiol, honokiol, magnolol, obovatol)
- Loreclezole
- Menthyl isovalerate (validolum)
- Monastrol
- Niacin
- Niacinamide
- Org 25,435
- Phenytoin
- Propanidid
- Retigabine (ezogabine)
- Safranal
- Seproxetine
- Stiripentol
- Sulfonylalkanes (e.g., sulfonmethane (sulfonal), tetronal, trional)
- Terpenoids (e.g., borneol)
- Topiramate
- Valerian constituents (e.g., isovaleric acid, isovaleramide, valerenic acid, valerenol)
|
---|
|